CAS 439692-90-7
:4-chloro-5-ethyl-6-methyl-thieno[2,3-d]pyrimidine
Description:
4-Chloro-5-ethyl-6-methyl-thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. The presence of chlorine, ethyl, and methyl substituents on the pyrimidine ring influences its reactivity and solubility. This compound typically exhibits moderate to high lipophilicity due to its hydrophobic substituents, which can affect its biological activity and interaction with cellular targets. It may also display potential as a pharmacological agent, given the structural motifs common in medicinal chemistry. The thieno[2,3-d]pyrimidine framework is often associated with various biological activities, including antimicrobial and anticancer properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest in synthetic organic chemistry and drug development. Overall, 4-chloro-5-ethyl-6-methyl-thieno[2,3-d]pyrimidine represents a versatile scaffold for further exploration in both research and application.
Formula:C9H9ClN2S
InChI:InChI=1/C9H9ClN2S/c1-3-6-5(2)13-9-7(6)8(10)11-4-12-9/h4H,3H2,1-2H3
SMILES:CCc1c(C)sc2c1c(Cl)ncn2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
