CAS 439693-52-4

6-tert-butyl-4-chlorothieno[3,2-d]pyrimidine

Description:

6-tert-butyl-4-chlorothieno[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its unique thieno-pyrimidine structure, which incorporates both sulfur and nitrogen atoms in its ring system. The presence of a tert-butyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. The chlorine substituent at the 4-position contributes to its reactivity and may affect its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as thieno[3,2-d]pyrimidines have been explored for various biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for diverse chemical modifications, which can be tailored to optimize its pharmacological profile. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, making it a valuable candidate for further research in drug development and synthetic chemistry.

Formula: C₁₀H₁₁ClN₂S

InChI: InChI=1/C10H11ClN2S/c1-10(2,3)7-4-6-8(14-7)9(11)13-5-12-6/h4-5H,1-3H3

SMILES: CC(C)(C)c1cc2c(c(Cl)ncn2)s1

Synonyms:

• Thieno[3,2-d]pyrimidine, 4-chloro-6-(1,1-dimethylethyl)-
• 6-tert-Butyl-4-chlorothieno[3,2-d]pyrimidine

6-t-Butyl-4-chlorothieno[3,2-d]pyrimidine

CAS: 439693-52-4

Formula: C₁₀H₁₁ClN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 226.7257

Ref: IN-DA00DD9P

6-(tert-Butyl)-4-chlorothieno[3,2-d]pyrimidine

CAS: 439693-52-4

6-(tert-Butyl)-4-chlorothieno[3,2-d]pyrimidine

Formula: C₁₀H₁₁ClN₂S

Purity: 97%

Color and Shape: yellow crystalline powder

Molecular weight: 226.73g/mol

Ref: 54-OR110628

6-t-Butyl-4-chlorothieno[3,2-d]pyrimidine

CAS: 439693-52-4

Formula: C₁₀H₁₁ClN₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 226.72

Ref: 10-F017501