CymitQuimica logo

CAS 439797-69-0

:

4,4'-Dibromo-2-nitrobiphenyl

Description:
4,4'-Dibromo-2-nitrobiphenyl is an organic compound characterized by its biphenyl structure, where two phenyl rings are connected by a single bond. This compound features two bromine atoms and one nitro group (-NO2) attached to the biphenyl framework, specifically at the 4 and 2 positions, respectively. The presence of bromine atoms contributes to its halogenated nature, which can influence its reactivity and physical properties, such as solubility and melting point. The nitro group introduces a strong electron-withdrawing effect, which can affect the compound's chemical behavior, including its reactivity in electrophilic substitution reactions. 4,4'-Dibromo-2-nitrobiphenyl is typically used in research and industrial applications, particularly in the synthesis of other chemical compounds and materials. Safety considerations should be taken into account when handling this substance, as halogenated compounds can pose environmental and health risks. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.
Formula:C12H7Br2NO2
InChI:InChI=1/C12H7Br2NO2/c13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15(16)17/h1-7H
InChI key:FMSJGXRUJCWSJL-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1ccc(cc1N(=O)=O)Br)Br
Synonyms:
  • 1,1'-Biphenyl, 4,4'-dibromo-2-nitro-
  • K0131
Found 4 products.