CAS 439809-44-6

Ethanaminium, 2-[[hydroxy(1H-indol-3-yloxy)phosphinyl]oxy]-N,N,N-trimethyl-, inner salt

Description:

Ethanaminium, 2-[[hydroxy(1H-indol-3-yloxy)phosphinyl]oxy]-N,N,N-trimethyl-, inner salt, identified by CAS number 439809-44-6, is a chemical compound characterized by its complex structure that includes an ethanaminium core, a phosphinyl group, and an indole moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as high solubility in polar solvents and potential biological activity due to the presence of the indole structure, which is known for its role in various biochemical processes. The phosphinyl group may impart additional reactivity and functionality, making it of interest in medicinal chemistry and drug design. The inner salt formation suggests that the compound may exist in a stable ionic form, which can influence its interaction with biological targets. Overall, this compound's unique combination of functional groups may contribute to its potential applications in pharmaceuticals or as a biochemical probe. Further studies would be necessary to elucidate its specific properties and potential uses in various fields.

Formula: C₁₃H₁₉N₂O₄P

InChI: InChI=1S/C13H19N2O4P/c1-15(2,3)8-9-18-20(16,17)19-13-10-14-12-7-5-4-6-11(12)13/h4-7,10,14H,8-9H2,1-3H3

InChI key: InChIKey=BUOOPGZGLXBVCI-UHFFFAOYSA-N

SMILES: O(P(OCC[N+](C)(C)C)(=O)[O-])C=1C=2C(NC1)=CC=CC2

Synonyms:

• 1H-Indol-3-yl (2-(trimethylammonio)ethyl) phosphate
• Ethanaminium, 2-[[hydroxy(1H-indol-3-yloxy)phosphinyl]oxy]-N,N,N-trimethyl-, inner salt
• 3-Indoxyl choline phosphate

3-INDOXYL CHOLINE PHOSPHATE

CAS: 439809-44-6

Formula: C₁₃H₁₉N₂O₄P

Molecular weight: 298.2747

Ref: IN-DA00D9TK

3-Indoxyl choline phosphate

CAS: 439809-44-6

Please enquire for more information about 3-Indoxyl choline phosphate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₉N₂O₄P

Purity: Min. 99 Area-%

Molecular weight: 298.28 g/mol

Ref: 3D-I-5696