CAS 439937-54-9

methyl 5-bromo-2-ethyl-benzoate

Description:

Methyl 5-bromo-2-ethyl-benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a bromine atom at the 5-position and an ethyl group at the 2-position of the benzene ring, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic aromatic structure. Methyl 5-bromo-2-ethyl-benzoate can be used in various applications, including as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.

Formula: C₁₀H₁₁BrO₂

InChI: InChI=1/C10H11BrO2/c1-3-7-4-5-8(11)6-9(7)10(12)13-2/h4-6H,3H2,1-2H3

SMILES: CCc1ccc(cc1C(=O)OC)Br

5-broMo-2-ethylbenzoic acid Methyl ester

CAS: 439937-54-9

Formula: C₁₀H₁₁BrO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 243.0971

Ref: IN-DA00DPSW

Methyl 5-bromo-2-ethylbenzoate

CAS: 439937-54-9

Methyl 5-bromo-2-ethylbenzoate

Purity: 98%

Molecular weight: 243.10g/mol

Ref: 54-OR90445

Methyl 5-bromo-2-ethylbenzoate

CAS: 439937-54-9

Formula: C₁₀H₁₁BrO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 243.1

Ref: 10-F328165