CAS 439937-63-0
:1-butyl-3-(4-sulfobutyl)-1H-imidazol-3-ium trifluoromethanesulfonate
Description:
1-Butyl-3-(4-sulfobutyl)-1H-imidazol-3-ium trifluoromethanesulfonate is an ionic liquid characterized by its unique structure and properties. This compound features a butyl group and a sulfobutyl group attached to an imidazolium ring, which contributes to its solubility and stability in various solvents. The trifluoromethanesulfonate anion enhances its ionic character, making it a good candidate for applications in electrochemistry and as a solvent for organic reactions. Its ionic nature typically results in low volatility and high thermal stability, which are advantageous for many industrial processes. Additionally, the presence of the sulfonate group can impart hydrophilicity, allowing for potential use in aqueous systems. This compound may also exhibit interesting electrochemical properties, making it suitable for use in batteries or as an electrolyte in fuel cells. Overall, its unique combination of structural features and properties positions it as a versatile substance in both research and industrial applications.
Formula:C12H21F3N2O6S2
InChI:InChI=1/C11H20N2O3S.CHF3O3S/c1-2-3-6-12-8-9-13(11-12)7-4-5-10-17(14,15)16;2-1(3,4)8(5,6)7/h8-9,11H,2-7,10H2,1H3;(H,5,6,7)
SMILES:CCCC[n+]1ccn(CCCC[S-](=O)(=O)=O)c1.C(F)(F)(F)S(=O)(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(3-Butyl-1-imidazolio)-1-butanesulfonic acid triflate
CAS:Formula:C12H21F3N2O6S2Purity:97%Color and Shape:LiquidMolecular weight:410.43011-Butyl-3-(4-Sulfobutyl)-1H-Imidazol-3-Ium Trifluoromethanesulfonate
CAS:1-Butyl-3-(4-Sulfobutyl)-1H-Imidazol-3-Ium TrifluoromethanesulfonatePurity:98%Molecular weight:410.43g/mol1-Butyl-3-(4-sulfobutyl)-1h-imidazol-3-ium tifluoromethanesulfonate
CAS:1-Butyl-3-(4-sulfobutyl)-1H-imidazolium tifluoromethanesulfonate is a solvating agent that can be used in sensors, research, and robotics. It has the potential to be a functional group for polymers, which could be customized for specific purposes. 1-Butyl-3-(4-sulfobutyl)-1H-imidazolium tifluoromethanesulfonate can also function as an eutectic solvent and provide a new way to study nanowires and nanomaterials. This solvating agent is mainly used in polymerized organic materials, such as polyurethane coatings.Formula:C12H21F3N2O6S2Purity:Min. 95%Color and Shape:PowderMolecular weight:410.43 g/mol


