CymitQuimica logo

CAS 440124-25-4

:

3-Bromo-5-chloropyrazine-2-carbonitrile

Description:
3-Bromo-5-chloropyrazine-2-carbonitrile is a heterocyclic organic compound characterized by its pyrazine ring, which contains both bromine and chlorine substituents, as well as a cyano group. The presence of these halogens and the cyano group contributes to its reactivity and potential applications in various chemical syntheses. This compound typically exhibits a pale to light-colored appearance and is soluble in polar organic solvents. Its molecular structure allows for potential interactions in biological systems, making it of interest in pharmaceutical research. The bromine and chlorine atoms can influence the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the cyano group can serve as a versatile functional group for further chemical modifications. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 3-Bromo-5-chloropyrazine-2-carbonitrile is a valuable compound in synthetic organic chemistry and medicinal chemistry research.
Formula:C5HBrClN3
InChI:InChI=1/C5HBrClN3/c6-5-3(1-8)9-2-4(7)10-5/h2H
SMILES:C(#N)c1c(Br)nc(cn1)Cl
Synonyms:
  • 2-Pyrazinecarbonitrile, 3-Bromo-5-Chloro-
  • 3-Bromo-5-chloropyrazine-2-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.