CAS 4403-71-8
:4-Aminobenzylamine
Description:
4-Aminobenzylamine, with the CAS number 4403-71-8, is an organic compound characterized by the presence of an amino group (-NH2) and a benzylamine structure. It features a benzene ring substituted with an amino group at the para position relative to the benzylamine moiety. This compound is typically a colorless to light yellow solid and is soluble in water and organic solvents, reflecting its polar nature due to the amino group. 4-Aminobenzylamine is known for its reactivity, particularly in nucleophilic substitution reactions, and can participate in various chemical transformations, making it useful in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, it exhibits potential biological activity, which may include antimicrobial and anti-inflammatory properties. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c8-5-6-1-3-7(9)4-2-6/h1-4H,5,8-9H2
InChI key:InChIKey=BFWYZZPDZZGSLJ-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(N)C=C1
Synonyms:- 4-(Aminomethyl)Aniline
- 4-Aminobenzenemethanamine
- 4-Aminobenzylamine
- 4-Aminomethylphenylamine
- Benzenemethanamine, 4-amino-
- Toluene-α,4-diamine
- p-(Aminomethyl)aniline
- p-Aminobenzylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Aminobenzylamine
CAS:Formula:C7H10N2Purity:>98.0%(GC)(T)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:122.174-(Aminomethyl)aniline
CAS:4-(Aminomethyl)anilineFormula:C7H10N2Purity:98%Color and Shape: yellow to light brown. low melting solidMolecular weight:122.17g/mol4-Aminobenzylamine
CAS:<p>4-Aminobenzylamine is a triazine compound that has two nitrogen atoms, each of which carries a proton. The protonated amines are reactive and can undergo diazonium salt formation with the nitrous acid. 4-Aminobenzylamine has been shown to have biological properties, such as inhibiting protein synthesis in various cells types. It inhibits the growth of multi-walled carbon nanotubes (MWNTs) by blocking the lysine residues on the surface of these MWNTs. 4-Aminobenzylamine also binds to magnetic resonance spectroscopy (NMR) and exhibits a characteristic spectrum with an alpha peak at about -0.2 ppm, indicative of a hydrogen bond between the amine group and one of the hydrogens in water molecules.</p>Formula:C7H10N2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:122.17 g/mol4-(Aminomethyl)aniline
CAS:Formula:C7H10N2Purity:95.0%Color and Shape:Solid, Low Melting SolidMolecular weight:122.171




