CAS 440341-60-6
:N-(2-fluorobenzoyl)-beta-alanine
Description:
N-(2-fluorobenzoyl)-beta-alanine is an organic compound characterized by its structure, which includes a beta-alanine moiety linked to a 2-fluorobenzoyl group. This compound features a fluorine atom substituted on the benzene ring, which can influence its chemical reactivity and biological activity. The presence of the carboxylic acid and amine functional groups in beta-alanine contributes to its properties as an amino acid derivative. Typically, compounds like this may exhibit polar characteristics due to the functional groups, potentially leading to solubility in polar solvents. The fluorine substitution can enhance lipophilicity and may affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may be studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. As with many chemical substances, safety data and handling precautions should be considered, especially regarding its reactivity and potential toxicity.
Formula:C10H10FNO3
InChI:InChI=1/C10H10FNO3/c11-8-4-2-1-3-7(8)10(15)12-6-5-9(13)14/h1-4H,5-6H2,(H,12,15)(H,13,14)
SMILES:c1ccc(c(c1)C(=NCCC(=O)O)O)F
Synonyms:- 3-[(2-Fluorobenzoyl)Amino]Propanoic Acid
- N-(2-Fluorobenzoyl)-β-alanine
- β-alanine, N-(2-fluorobenzoyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Fluorobenzamido)propanoic acid
CAS:Formula:C10H10FNO3Color and Shape:SolidMolecular weight:211.1897
