CAS 440367-79-3

6-[[Bis(2-pyridinylmethyl)amino]methyl]-3-pyridinecarboxylic acid

Description:

6-[[Bis(2-pyridinylmethyl)amino]methyl]-3-pyridinecarboxylic acid, with CAS number 440367-79-3, is a complex organic compound characterized by its pyridine-based structure. This substance features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of two pyridinylmethyl groups indicates that it has significant coordination chemistry potential, making it a candidate for metal ion chelation. The compound is likely to exhibit solubility in polar solvents due to its functional groups, and its molecular structure suggests it may participate in hydrogen bonding, influencing its physical properties such as melting point and boiling point. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a ligand in coordination chemistry. Its unique structure allows for potential interactions with biological targets, which could be explored in drug design or as a research tool in biochemical studies. Overall, this compound exemplifies the intersection of organic chemistry and coordination chemistry.

Formula: C₁₉H₁₈N₄O₂

InChI: InChI=1S/C19H18N4O2/c24-19(25)15-7-8-18(22-11-15)14-23(12-16-5-1-3-9-20-16)13-17-6-2-4-10-21-17/h1-11H,12-14H2,(H,24,25)

InChI key: InChIKey=LEUMMUGJQNPJQK-UHFFFAOYSA-N

SMILES: N(CC1=CC=C(C(O)=O)C=N1)(CC2=CC=CC=N2)CC3=CC=CC=N3

Synonyms:

• 6-[[Bis(2-pyridinylmethyl)amino]methyl]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-[[bis(2-pyridinylmethyl)amino]methyl]-