CAS 4405-28-1

2-(dimethylamino)-5-nitrobenzoic acid

Description:

2-(Dimethylamino)-5-nitrobenzoic acid, with the CAS number 4405-28-1, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a nitro group and a dimethylamino group. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and acidity. The dimethylamino group, on the other hand, is a strong electron-donating group, which can enhance nucleophilicity and affect the compound's overall chemical behavior. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or other chemical entities. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a reaction. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1/C9H10N2O4/c1-10(2)8-4-3-6(11(14)15)5-7(8)9(12)13/h3-5H,1-2H3,(H,12,13)

SMILES: CN(C)c1ccc(cc1C(=O)O)N(=O)=O

2-(Dimethylamino)-5-nitrobenzoic acid

CAS: 4405-28-1

Formula: C₉H₁₀N₂O₄

Purity: 98%

Molecular weight: 210.1867

Ref: IN-DA00DIP9

2-(Dimethylamino)-5-nitrobenzoic acid

CAS: 4405-28-1

2-(Dimethylamino)-5-nitrobenzoic acid

Purity: 98%

Molecular weight: 210.19g/mol

Ref: 54-OR78070

2-(DIMETHYLAMINO)-5-NITROBENZOIC ACID

CAS: 4405-28-1

Formula: C₉H₁₀N₂O₄

Purity: 98%

Molecular weight: 210.189

Ref: 10-F506000

2-(Dimethylamino)-5-nitrobenzoic Acid

Controlled Product

CAS: 4405-28-1

Formula: C₉H₁₀N₂O₄

Color and Shape: Neat

Molecular weight: 210.187

Ref: TR-B402618

2-(dimethylamino)-5-nitrobenzoic acid

CAS: 4405-28-1

Versatile small molecule scaffold

Formula: C₉H₁₀N₂O₄

Purity: Min. 95%

Molecular weight: 210.2 g/mol

Ref: 3D-EAA40528