CAS 440634-25-3

1,1-Dimethylethyl 4-[2-[4-[(methylsulfonyl)oxy]-1-piperidinyl]-2-oxoethyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[2-[4-[(methylsulfonyl)oxy]-1-piperidinyl]-2-oxoethyl]-1-piperidinecarboxylate, identified by CAS number 440634-25-3, is a chemical compound characterized by its complex structure, which includes multiple functional groups such as piperidine rings and a methylsulfonyl moiety. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the presence of ester and sulfonate groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to the piperidine rings that are often associated with biological activity. The presence of the methylsulfonyl group may enhance solubility and bioavailability. However, specific physical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization. Safety data and handling precautions should also be consulted due to the potential biological activity of the compound.

Formula: C₁₈H₃₂N₂O₆S

InChI: InChI=1S/C18H32N2O6S/c1-18(2,3)25-17(22)20-9-5-14(6-10-20)13-16(21)19-11-7-15(8-12-19)26-27(4,23)24/h14-15H,5-13H2,1-4H3

InChI key: InChIKey=HCPHGCCJTBULLI-UHFFFAOYSA-N

SMILES: C(C(=O)N1CCC(OS(C)(=O)=O)CC1)C2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 4-[2-[4-[(methylsulfonyl)oxy]-1-piperidinyl]-2-oxoethyl]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[2-[4-[(methylsulfonyl)oxy]-1-piperidinyl]-2-oxoethyl]-, 1,1-dimethylethyl ester
• 1-[(1-tert-Butoxycarbonyl-4-piperidyl)acetyl]-4-mesyloxypiperidine