CAS 4411-72-7
:N-(1,3-thiazol-2-yl)benzenesulfonamide
Description:
N-(1,3-thiazol-2-yl)benzenesulfonamide is a chemical compound characterized by its thiazole and sulfonamide functional groups. It typically appears as a solid, often crystalline, substance. The thiazole ring contributes to its heterocyclic nature, which can influence its biological activity and solubility. This compound is known for its potential applications in medicinal chemistry, particularly as an antibacterial or antifungal agent, due to the presence of the sulfonamide group, which is known for its ability to inhibit bacterial growth. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its reactivity and interaction with biological targets. Additionally, the compound may exhibit moderate to high polarity, influencing its solubility in different solvents. Its stability under standard conditions is generally good, although specific storage conditions may be recommended to maintain its integrity. Overall, N-(1,3-thiazol-2-yl)benzenesulfonamide is a compound of interest in pharmaceutical research and development.
Formula:C9H8N2O2S2
InChI:InChI=1/C9H8N2O2S2/c12-15(13,8-4-2-1-3-5-8)11-9-10-6-7-14-9/h1-7H,(H,10,11)
SMILES:c1ccc(cc1)S(=O)(=O)Nc1nccs1
Synonyms:- benzenesulfonamide, N-2-thiazolyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.