CAS 4411-80-7
:6,6′-Dimethyl-2,2′-bipyridine
Description:
6,6′-Dimethyl-2,2′-bipyridine, with the CAS number 4411-80-7, is an organic compound belonging to the bipyridine family, characterized by the presence of two pyridine rings connected by a carbon-carbon bond. This compound features two methyl groups attached to the 6-position of each pyridine ring, which influences its chemical properties and reactivity. It is typically a solid at room temperature and exhibits a pale yellow to white crystalline appearance. The presence of the methyl groups enhances its lipophilicity and can affect its coordination chemistry, making it a useful ligand in various metal complexes. 6,6′-Dimethyl-2,2′-bipyridine is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. It is often utilized in coordination chemistry, catalysis, and as a building block in organic synthesis due to its ability to form stable complexes with transition metals. Additionally, its structural features allow for potential applications in materials science and organic electronics.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12/h3-8H,1-2H3
InChI key:InChIKey=OHJPGUSXUGHOGE-UHFFFAOYSA-N
SMILES:CC1=NC(=CC=C1)C=2N=C(C)C=CC2
Synonyms:- 2,2′-Bipyridine, 6,6′-dimethyl-
- 2-Methyl-6-(6-methylpyridin-2-yl)pyridine
- 6,6'-Dimethyl-2,2'-Bipyridine
- 6,6-Bi-2-picoline
- 6,6-Dimethyl-2,2-dipyridyl
- 6,6′-Dimethyl-2,2′-bipyridyl
- NSC 4705
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6,6'-Dimethyl-2,2'-bipyridyl
CAS:Formula:C12H12N2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalineMolecular weight:184.246,6′-Dimethyl-2,2′-bipyridine
CAS:Formula:C12H12N2Purity:98%Color and Shape:White powderMolecular weight:184.2426,6'-Dimethyl-2,2'-bipyridine
CAS:Formula:C12H12N2Purity:98%Color and Shape:SolidMolecular weight:184.23716,6'-Dimethyl-2,2'-dipyridyl
CAS:6,6'-Dimethyl-2,2'-dipyridyl (6,6'-Bi-2-picoline) is a novel time-resolved fluorescent immunoassay (TRFIA) chelate with a good bactericidal effect for the studyFormula:C12H12N2Purity:99.96%Color and Shape:SolidMolecular weight:184.246,6'-Dimethyl-2,2'-bipyridine
CAS:6,6'-Dimethyl-2,2'-bipyridineFormula:C12H12N2Purity:98%Color and Shape: faint beige to light yellow solidMolecular weight:184.24g/mol6,6'-Dimethyl-2,2'-bipyridine
CAS:6,6'-Dimethyl-2,2'-bipyridine (DMBP) is a bidentate ligand that is used in the functional theory of antibacterial activity. The bond cleavage of DMBP is believed to be due to its high oxidation potential and its ability to form hydrogen bonds with the bacteria cell wall. DMBP has been shown to have an antibacterial effect on both Gram-positive and Gram-negative bacteria. The mechanism of action may be due to its ability to release hydroxyl radicals when exposed to ultraviolet light. This compound also has a boronic acid group that can form a complex with 4-methoxyphenylboronic acid (MPA) which can inhibit bacterial growth.Formula:C12H12N2Purity:Min. 98%Color and Shape:PowderMolecular weight:184.24 g/mol





