CAS 4412-16-2
:2-Dodecenoic acid
Description:
2-Dodecenoic acid, also known as 2-alkenoic acid, is a long-chain unsaturated fatty acid characterized by a double bond located at the second carbon of the dodecane chain. Its molecular formula is C12H22O2, and it features a carboxylic acid functional group, which imparts acidic properties. This compound is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. The presence of the double bond contributes to its reactivity, making it susceptible to oxidation and polymerization. 2-Dodecenoic acid is of interest in various applications, including the synthesis of surfactants, emulsifiers, and other chemical intermediates. Additionally, it can be found in certain natural sources and is studied for its potential biological activities. Safety considerations include handling it with care, as it may cause irritation upon contact with skin or eyes.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)
InChI key:InChIKey=PAWGRNGPMLVJQH-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C=CC(O)=O
Synonyms:- 2-Dodecenoic acid
- NSC 59856
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Dodec-2-enoic acid
CAS:<p>Dodec-2-enoic acid is a fatty acid that is produced by the oxidation of dodecanoic acid. It has been shown to inhibit the growth of bladder cancer cells and human pathogens, including Escherichia coli, Salmonella enterica, Staphylococcus aureus, and Pseudomonas aeruginosa. Dodec-2-enoic acid also inhibits efflux pumps in bacteria and has been shown to be a potential polymerase chain reaction (PCR) substrate. Dodec-2-enoic acid can be produced from fatty acids found in animal feedstocks. Dodec-2-enoic acid is an amide with an angular shape and isomerizes into its cis form when heated.</p>Formula:C12H22O2Purity:Min. 95%Molecular weight:198.3 g/mol



