
CAS 4414-50-0
:4-(2-Chlorophenyl)-2-methyl-3-furancarboxylic acid
Description:
4-(2-Chlorophenyl)-2-methyl-3-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring, a carboxylic acid functional group, and a chlorophenyl substituent. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic and polar characteristics. The presence of the carboxylic acid group contributes to its acidity, while the chlorophenyl moiety can influence its reactivity and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Safety data should be consulted for handling, as the chlorinated aromatic compounds can pose environmental and health risks. Overall, 4-(2-Chlorophenyl)-2-methyl-3-furancarboxylic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H9ClO3
InChI:InChI=1S/C12H9ClO3/c1-7-11(12(14)15)9(6-16-7)8-4-2-3-5-10(8)13/h2-6H,1H3,(H,14,15)
InChI key:InChIKey=BAHKVZJSCIMNJW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=COC1C)C2=C(Cl)C=CC=C2
Synonyms:- 4-(2-Chlorophenyl)-2-methyl-3-furancarboxylic acid
- 3-Furancarboxylic acid, 4-(2-chlorophenyl)-2-methyl-
- 3-Furoic acid, 4-(o-chlorophenyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
