CAS 4414-54-4

2,3-dichlorobenzaldehyde oxime

Description:

2,3-Dichlorobenzaldehyde oxime is an organic compound characterized by its oxime functional group attached to a dichlorobenzaldehyde moiety. It typically appears as a crystalline solid and is known for its distinctive aromatic properties due to the presence of the benzene ring. The compound features two chlorine atoms substituted at the 2 and 3 positions of the benzene ring, which can influence its reactivity and physical properties, such as solubility and boiling point. As an oxime, it contains a hydroxylamine group (-C=N-OH), which can participate in various chemical reactions, including condensation and rearrangement reactions. 2,3-Dichlorobenzaldehyde oxime is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity can be affected by the electron-withdrawing nature of the chlorine substituents, making it a valuable compound in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₇H₅Cl₂NO

InChI: InChI=1/C7H5Cl2NO/c8-6-3-1-2-5(4-10-11)7(6)9/h1-4,11H

SMILES: c1cc(C=NO)c(c(c1)Cl)Cl

Synonyms:

• 1-(2,3-dichlorophenyl)-N-hydroxymethanimine

2,3-Dichlorobenzaldoxime

CAS: 4414-54-4

2,3-Dichlorobenzaldoxime

Formula: C₇H₅Cl₂NO

Purity: ≥95%

Color and Shape: beige crystalline powder

Molecular weight: 190.0267g/mol

Ref: 54-OR0337

2,3-Dichlorobenzaldehyde oxime

CAS: 4414-54-4

2,3-Dichlorobenzaldehyde oxime is a versatile building block and reagent in the synthesis of complex compounds. It is mainly used as a research chemical and speciality chemical. 2,3-Dichlorobenzaldehyde oxime has been widely used for the preparation of fine chemicals, pharmaceuticals, agrochemicals, and other organic compounds. This compound can be reacted with various reagents to produce useful scaffolds or reaction components.

Formula: C₇H₅Cl₂NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 190.03 g/mol

Ref: 3D-FD67865

(E)-2,3-dichlorobenzaldehyde oxime

CAS: 4414-54-4

Purity: 98%

Molecular weight: 190.0200043

Ref: 10-F773863