
CAS 4414-80-6
:2-Methyl-1H-indole-1-propanenitrile
Description:
2-Methyl-1H-indole-1-propanenitrile, with the CAS number 4414-80-6, is an organic compound that features a fused indole structure with a propanenitrile functional group. This compound is characterized by its aromatic indole ring, which contributes to its stability and potential biological activity. The presence of the methyl group at the 2-position of the indole enhances its lipophilicity, potentially influencing its interactions in biological systems. The propanenitrile moiety introduces a polar functional group, which can participate in various chemical reactions, including nucleophilic additions and substitutions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility and reactivity can vary depending on the solvent and conditions used, and it may be synthesized through various organic reactions involving indole derivatives. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-10-9-11-5-2-3-6-12(11)14(10)8-4-7-13/h2-3,5-6,9H,4,8H2,1H3
InChI key:InChIKey=LDRXJHFTIOBRGI-UHFFFAOYSA-N
SMILES:C(CC#N)N1C=2C(C=C1C)=CC=CC2
Synonyms:- 1H-Indole-1-propanenitrile, 2-methyl-
- 2-Methyl-1H-indole-1-propanenitrile
- Indole-1-propionitrile, 2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.