CAS 4415-73-0

1,1-Bis(hydroxymethyl)cyclobutane

Description:

1,1-Bis(hydroxymethyl)cyclobutane is an organic compound characterized by its unique cyclobutane ring structure, which is a four-membered carbon ring. This compound features two hydroxymethyl (-CH2OH) groups attached to the same carbon atom of the cyclobutane, making it a diol. Its molecular formula reflects the presence of multiple functional groups, contributing to its reactivity and potential applications in organic synthesis and polymer chemistry. The hydroxymethyl groups enhance its solubility in polar solvents and can participate in various chemical reactions, such as esterification and etherification. Additionally, the compound may exhibit interesting physical properties, including a relatively low boiling point and moderate stability under standard conditions. Its structural characteristics suggest potential uses in the development of cross-linking agents or as a building block in the synthesis of more complex organic molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₆H₁₂O₂

InChI: InChI=1/C6H12O2/c7-4-6(5-8)2-1-3-6/h7-8H,1-5H2

SMILES: C1CC(C1)(CO)CO

Synonyms:

• 1,1-Cyclobutanedimethanol
• Cyclobutane-1,1-Diyldimethanol

CYCLOBUTANE-1,1-DIYLDIMETHANOL

CAS: 4415-73-0

Formula: C₆H₁₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 116.1583

Ref: IN-DA00DB9N

Cyclobutane-1,1-diyldimethanol

CAS: 4415-73-0

Cyclobutane-1,1-diyldimethanol

Formula: C₆H₁₂O₂

Purity: 95%

Color and Shape: pale yellow solid

Molecular weight: 116.16g/mol

Ref: 54-OR312194

CYCLOBUTANE-1,1-DIYLDIMETHANOL

CAS: 4415-73-0

Formula: C₆H₁₂O₂

Purity: 97%

Color and Shape: Liquid, Oil

Molecular weight: 116.16

Ref: 10-F470196

1,1-Bis(hydroxymethyl)cyclobutane

CAS: 4415-73-0

1,1-Bis(hydroxymethyl)cyclobutane is a reactive compound that can be used as a binder in the production of polyurethane foam. It has been shown to react with chloropropane, malonate, vinyl ethers and oxetanes, alkylating them with the hydroxyl group on the cyclobutane ring. This reaction takes place within a few hours at room temperature. 1,1-Bis(hydroxymethyl)cyclobutane forms diethyl ester when reacted with ethyl bromoacetate or nitrate. The deamination of 1,1-bis(hydroxymethyl)cyclobutane occurs by hydrolysis of the esters and amides. Dichloroketene is formed from this reaction.

Formula: C₆H₁₂O₂

Purity: Min. 95%

Molecular weight: 116.16 g/mol

Ref: 3D-FB150862