CAS 4415-73-0
:1,1-Bis(hydroxymethyl)cyclobutane
Description:
1,1-Bis(hydroxymethyl)cyclobutane is an organic compound characterized by its unique cyclobutane ring structure, which is a four-membered carbon ring. This compound features two hydroxymethyl (-CH2OH) groups attached to the same carbon atom of the cyclobutane, making it a diol. Its molecular formula reflects the presence of multiple functional groups, contributing to its reactivity and potential applications in organic synthesis and polymer chemistry. The hydroxymethyl groups enhance its solubility in polar solvents and can participate in various chemical reactions, such as esterification and etherification. Additionally, the compound may exhibit interesting physical properties, including a relatively low boiling point and moderate stability under standard conditions. Its structural characteristics suggest potential uses in the development of cross-linking agents or as a building block in the synthesis of more complex organic molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C6H12O2
InChI:InChI=1/C6H12O2/c7-4-6(5-8)2-1-3-6/h7-8H,1-5H2
SMILES:C1CC(C1)(CO)CO
Synonyms:- 1,1-Cyclobutanedimethanol
- Cyclobutane-1,1-Diyldimethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
CYCLOBUTANE-1,1-DIYLDIMETHANOL
CAS:Formula:C6H12O2Purity:97%Color and Shape:LiquidMolecular weight:116.1583Ref: IN-DA00DB9N
1g50.00€5g127.00€10g189.00€25g256.00€250gTo inquire500gTo inquire250mg28.00€500mg50.00€Cyclobutane-1,1-diyldimethanol
CAS:Cyclobutane-1,1-diyldimethanolFormula:C6H12O2Purity:95%Color and Shape: pale yellow solidMolecular weight:116.16g/molCYCLOBUTANE-1,1-DIYLDIMETHANOL
CAS:Formula:C6H12O2Purity:97%Color and Shape:Liquid, OilMolecular weight:116.161,1-Bis(hydroxymethyl)cyclobutane
CAS:1,1-Bis(hydroxymethyl)cyclobutane is a reactive compound that can be used as a binder in the production of polyurethane foam. It has been shown to react with chloropropane, malonate, vinyl ethers and oxetanes, alkylating them with the hydroxyl group on the cyclobutane ring. This reaction takes place within a few hours at room temperature. 1,1-Bis(hydroxymethyl)cyclobutane forms diethyl ester when reacted with ethyl bromoacetate or nitrate. The deamination of 1,1-bis(hydroxymethyl)cyclobutane occurs by hydrolysis of the esters and amides. Dichloroketene is formed from this reaction.Formula:C6H12O2Purity:Min. 95%Molecular weight:116.16 g/mol



