CAS 441774-72-7

2,8-Dioxaspiro[4.5]decan-3-one

Description:

2,8-Dioxaspiro[4.5]decan-3-one is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with two oxygen atoms incorporated into the ring system. This compound belongs to the class of spiro compounds, which are known for their distinctive geometry and potential applications in medicinal chemistry and materials science. The presence of the dioxaspiro moiety suggests that it may exhibit interesting chemical reactivity and stability due to the cyclic ether functionalities. Typically, compounds like 2,8-Dioxaspiro[4.5]decan-3-one may possess properties such as moderate solubility in organic solvents and potential for forming hydrogen bonds, which can influence their interactions in biological systems. Additionally, the compound's structure may allow for various synthetic modifications, making it a candidate for further research in drug development or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.

Formula: C₈H₁₂O₃

InChI: InChI=1S/C8H12O3/c9-7-5-8(6-11-7)1-3-10-4-2-8/h1-6H2

InChI key: InChIKey=XJJUVADISIKAQD-UHFFFAOYSA-N

SMILES: O=C1CC2(CO1)CCOCC2

Synonyms:

• 2,8-Dioxaspiro[4.5]decan-3-one

2,8-Dioxaspiro[4.5]decan-3-one

CAS: 441774-72-7

Versatile small molecule scaffold

Formula: C₈H₁₂O₃

Purity: Min. 95%

Molecular weight: 156.2 g/mol

Ref: 3D-RSA77472