CymitQuimica logo

CAS 441798-36-3

:

N-[6-[2-[(5-Bromo-2-pyrimidinyl)oxy]ethoxy]-5-(4-chlorophenyl)-4-pyrimidinyl]-N′-propylsulfamide

Description:
N-[6-[2-[(5-Bromo-2-pyrimidinyl)oxy]ethoxy]-5-(4-chlorophenyl)-4-pyrimidinyl]-N′-propylsulfamide, with CAS number 441798-36-3, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic and heterocyclic rings. This compound features a pyrimidine core, which is a six-membered ring containing nitrogen atoms, contributing to its potential biological activity. The presence of a bromine atom and a chlorophenyl group suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The sulfonamide functional group is known for its role in various pharmacological applications, particularly as antibacterial agents. Additionally, the ethoxy and propyl substituents may influence the compound's solubility and permeability, affecting its bioavailability. Overall, this compound's unique structural features may confer specific properties that could be explored in drug development and therapeutic applications. However, detailed studies would be necessary to fully understand its biological activity and potential uses.
Formula:C19H20BrClN6O4S
InChI:InChI=1S/C19H20BrClN6O4S/c1-2-7-26-32(28,29)27-17-16(13-3-5-15(21)6-4-13)18(25-12-24-17)30-8-9-31-19-22-10-14(20)11-23-19/h3-6,10-12,26H,2,7-9H2,1H3,(H,24,25,27)
InChI key:InChIKey=OXHAHXSAOMBNOX-UHFFFAOYSA-N
SMILES:N(S(NCCC)(=O)=O)C=1C(=C(OCCOC=2N=CC(Br)=CN2)N=CN1)C3=CC=C(Cl)C=C3
Synonyms:
  • N-[6-[2-[(5-Bromo-2-pyrimidinyl)oxy]ethoxy]-5-(4-chlorophenyl)-4-pyrimidinyl]-N′-propylsulfamide
  • Sulfamide, N-[6-[2-[(5-bromo-2-pyrimidinyl)oxy]ethoxy]-5-(4-chlorophenyl)-4-pyrimidinyl]-N′-propyl-
  • Macitentan 4-Chloro Analog
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.