CAS 4418-57-9

5-ethyl-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-Ethyl-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 4418-57-9, is a heterocyclic compound characterized by its triazole ring structure, which contains nitrogen atoms in the ring. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazole framework. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen and sulfur atoms, which can engage in hydrogen bonding. The compound is of interest in various fields, including agricultural chemistry, where it may serve as a precursor or active ingredient in fungicides or herbicides. Its unique structure contributes to its biological activity, making it a subject of research for potential applications in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₉N₃S

InChI: InChI=1/C5H9N3S/c1-3-4-6-7-5(9)8(4)2/h3H2,1-2H3,(H,7,9)

SMILES: CCc1nnc(n1C)S

Synonyms:

• 4H-1,2,4-Triazole-3-thiol, 5-ethyl-4-methyl-
• 5-Ethyl-4-methyl-4H-1,2,4-triazole-3-thiol

5-Ethyl-4-methyl-4H-[1,2,4]triazole-3-thiol

CAS: 4418-57-9

Formula: C₅H₉N₃S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 143.21

Ref: 10-F026027