CAS 4424-17-3
:2-Amino-N-phenylbenzamide
Description:
2-Amino-N-phenylbenzamide, also known by its CAS number 4424-17-3, is an organic compound characterized by the presence of an amino group and a phenyl group attached to a benzamide structure. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The amino group (-NH2) contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, such as acylation or coupling reactions. The phenyl group enhances the compound's stability and can influence its electronic properties, making it useful in various applications, including pharmaceuticals and organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H12N2O
InChI:InChI=1S/C13H12N2O/c14-12-9-5-4-8-11(12)13(16)15-10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16)
InChI key:InChIKey=FDPVTENMNDHFNK-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2=C(N)C=CC=C2
Synonyms:- 2-(N-Phenylcarbamoyl)aniline
- 2-Amino-N-phenylbenzamide~Phenylanthranilamide
- 2-amino-N-phenylbenzamide
- Anthranilanilide
- Benzamide, 2-amino-N-phenyl-
- Benzanilide, 2-amino-
- N-(2-Aminobenzoyl)aniline
- N-(2-Aminobenzoyl)phenylamine
- N-(2-aminophenyl)benzamide
- N-Phenyl-2-aminobenzamide
- N-Phenylanthranilamide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-(2-Aminophenyl)benzamide
CAS:Formula:C13H12N2OPurity:95%Color and Shape:SolidMolecular weight:212.24722-Amino-N-phenylbenzamide
CAS:2-Amino-N-phenylbenzamideFormula:C13H12N2OPurity:97%Color and Shape: off-white powderMolecular weight:212.25g/mol2-Amino-N-phenylbenzamide
CAS:Formula:C13H12N2OPurity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:212.252-Aminobenzanilide
CAS:2-Aminobenzanilide is a chemical compound that has been found to have antimycobacterial activity. It is an allosteric inhibitor of the ribosome-inactivating protein (RIP) which inhibits the production of tnf-α, a proinflammatory cytokine. 2-Aminobenzanilide has also been shown to inhibit the growth of cancer cells in various in vitro assays and inhibits tumor growth in vivo. It binds to sulfonic acid groups on the surface of bacterial cell walls and alters their permeability, thus inhibiting the synthesis of proteins vital for cell division. 2-Aminobenzanilide has also been shown to react with acetylated salicylic acid ligands.Formula:C13H12N2OPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:212.25 g/mol2-Aminobenzanilide
CAS:2-Aminobenzamide: a stable, neutral fluorescent tag used in glycan analysis and as a precursor for key reactions.Formula:C13H12N2OPurity:98%Color and Shape:SolidMolecular weight:212.25





