CAS 4424-20-8

2,3,4,5-tetrahydro-1H-3-benzazepine

Description:

2,3,4,5-Tetrahydro-1H-3-benzazepine is a bicyclic organic compound characterized by its unique structure, which consists of a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features a saturated framework, with four carbon atoms and one nitrogen atom in the azepine ring, contributing to its distinct chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the nitrogen atom in the ring can influence its reactivity and potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The compound may exhibit various functional properties, including potential pharmacological activities, due to its structural similarity to other biologically active molecules. Its CAS number, 4424-20-8, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, 2,3,4,5-tetrahydro-1H-3-benzazepine represents a significant class of compounds with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₃N

InChI: InChI=1/C10H13N/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1-4,11H,5-8H2

SMILES: c1ccc2CCNCCc2c1

Synonyms:

• 1H-3-Benzazepine, 2,3,4,5-tetrahydro-
• 2,3,4,5-Tetrahydro-1H-benzo[d]azepine

2,3,4,5-Tetrahydro-1H-benzo[d]azepine

CAS: 4424-20-8

Formula: C₁₀H₁₃N

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.2169

Ref: IN-DA00729B

2,3,4,5-Tetrahydro-1H-benzo[d]azepine

CAS: 4424-20-8

2,3,4,5-Tetrahydro-1H-benzo[d]azepine

Formula: C₁₀H₁₃N

Purity: 90%

Color and Shape: clear. brown liquid

Molecular weight: 147.22g/mol

Ref: 54-OR318069

2,3,4,5-Tetrahydro-1H-benzo[d]azepine

CAS: 4424-20-8

Formula: C₁₀H₁₃N

Purity: 95%

Color and Shape: Oil

Molecular weight: 147.221

Ref: 10-F046252

5-Azabenzocycloheptene

Controlled Product

CAS: 4424-20-8

Applications 5-Azabenzocycloheptene is a reactant used in the synthesis of nonretinoid retinol binding protein 4 antagonists for potential treatment of atrophic age-related macular degeneration and Stargardt disease.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Cioffi, C.L., et. al.: J. Med. Chem. 57, 7731 (2014)

Formula: C₁₀H₁₃N

Color and Shape: Neat

Molecular weight: 147.22

Ref: TR-A795190