CAS 4424-80-0: 1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one
Description:1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one is a bicyclic compound that belongs to the class of benzazepines, which are characterized by a fused benzene and azepine ring structure. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the azepine ring, contributing to its stability and reactivity. The presence of a carbonyl group (ketone) at the 2-position of the azepine ring is significant, as it can influence the compound's chemical behavior, including its reactivity and potential interactions with biological systems. The molecular structure allows for various stereochemical configurations, which can affect its pharmacological properties. Typically, compounds in this class may exhibit a range of biological activities, including potential neuroactive effects, making them of interest in medicinal chemistry. The compound's CAS number, 4424-80-0, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c12-10-7-3-5-8-4-1-2-6-9(8)11-10/h1-2,4,6H,3,5,7H2,(H,11,12)
- Synonyms:
- 4,5-Dihydro-1-benzoazepin-2(3H)-one
