CAS 442517-33-1

6-ethynylquinoxaline

Description:

6-Ethynylquinoxaline is a heterocyclic organic compound characterized by the presence of a quinoxaline core, which consists of a fused bicyclic structure containing two nitrogen atoms. The ethynyl group, a terminal alkyne, is attached at the 6-position of the quinoxaline ring, contributing to its reactivity and potential applications in various fields. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its unique structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and materials science. Additionally, 6-ethynylquinoxaline may participate in various chemical reactions, including cross-coupling and cycloaddition, which can be exploited for synthesizing more complex molecules. The compound's specific reactivity and applications can vary based on the functional groups present and the conditions under which it is used. Overall, 6-ethynylquinoxaline serves as a valuable building block in organic synthesis and research.

Formula: C₁₀H₆N₂

InChI: InChI=1/C10H6N2/c1-2-8-3-4-9-10(7-8)12-6-5-11-9/h1,3-7H

SMILES: C#Cc1ccc2c(c1)nccn2

Quinoxaline, 6-ethynyl-

CAS: 442517-33-1

Formula: C₁₀H₆N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.1680

Ref: IN-DA007299

6-Ethynylquinoxaline

CAS: 442517-33-1

6-Ethynylquinoxaline

Formula: C₁₀H₆N₂

Purity: 97%

Color and Shape: pale brown solid

Molecular weight: 154.17g/mol

Ref: 54-OR9199

6-Ethynylquinoxaline

CAS: 442517-33-1

Purity: 98%

Molecular weight: 154.1719971

Ref: 10-F676332

6-Ethynylquinoxaline

CAS: 442517-33-1

6-Ethynylquinoxaline is a growth factor inhibitor that binds to the type I receptor for the fibroblast growth factor (FGFR1). It binds to FGFR1 and blocks the activation of downstream kinase. 6-Ethynylquinoxaline has been shown to have an inhibitory effect on the proliferation of tumor cells in vitro and in vivo. 6-Ethynylquinoxaline was also shown to be an effective inhibitor of the growth factor β1, which is involved in tumor cell proliferation.

Formula: C₁₀H₆N₂

Purity: Min. 95%

Molecular weight: 154.17 g/mol

Ref: 3D-SSA51733