CAS 4426-21-5
:diphenylborinic anhydride
Description:
Diphenylborinic anhydride, with the CAS number 4426-21-5, is an organoboron compound characterized by its unique structure, which includes two phenyl groups attached to a boron atom, forming a borinic acid derivative. This compound typically appears as a white to light yellow solid and is known for its stability under ambient conditions. Diphenylborinic anhydride is primarily utilized in organic synthesis, particularly in the formation of boron-containing compounds and as a reagent in various chemical reactions, including those involving nucleophiles. Its reactivity is attributed to the presence of the boron atom, which can form coordinate bonds with electron-rich species. Additionally, it exhibits properties that make it useful in the development of materials and catalysts in polymer chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, diphenylborinic anhydride is a valuable compound in the field of synthetic organic chemistry and materials science.
Formula:C24H20B2O
InChI:InChI=1/C24H20B2O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)27-26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H
SMILES:c1ccc(cc1)B(c1ccccc1)OB(c1ccccc1)c1ccccc1
Synonyms:- Tetraphenyldiboroxane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Diphenylborinic anhydride, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C24H20B2OPurity:95%Color and Shape:White, Powder or crystalMolecular weight:346.04Diphenylborinic anhydride
CAS:Formula:C24H20B2OPurity:95%Color and Shape:SolidMolecular weight:346.0370Diphenylborinic Anhydride
CAS:Controlled ProductFormula:C24H20B2OColor and Shape:NeatMolecular weight:346.04Diphenyl-d20-borinic Anhydride
CAS:Controlled Product<p>Applications Diphenyl-d20-borinic Anhydride is the labeled analogue of Diphenylborinic Anhydride (D487370), which is used as a photopolymerization co-initiator.<br>References Santos, W.G., et. al.: 89, 1362 (2013)<br></p>Formula:C24D20B2OColor and Shape:NeatMolecular weight:366.16




