CAS 4426-76-0
:2-Isothiochroman-4-one
Description:
2-Isothiochroman-4-one is a heterocyclic organic compound characterized by a fused ring system that includes a thiophene and a carbonyl group. It features a bicyclic structure, which contributes to its unique chemical properties. The compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure includes a sulfur atom, which imparts distinct reactivity compared to similar compounds lacking sulfur. 2-Isothiochroman-4-one is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. The compound can undergo various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile intermediate in organic synthesis. Additionally, its derivatives may exhibit enhanced pharmacological effects, making it a subject of research in drug development. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C9H8OS
InChI:InChI=1/C9H8OS/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2
SMILES:c1ccc2c(c1)CSCC2=O
Synonyms:- Isothiochromanone
- Nsc 208878
- 1H-2-Benzothiopyran-4(3H)-one (9CI)
- 1H-isothiochromen-4(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Thioisochroman-4-one
CAS:<p>2-Thioisochroman-4-one is a hydrogen bond inhibitor that binds to the hydroxyl group of the enzyme. It has antiinflammatory activity, and has been shown to inhibit prostaglandin synthesis in vitro. 2-Thioisochroman-4-one also inhibits arachidonic acid release from membrane phospholipids by inhibiting phospholipase A2, and is thought to be an endogenous inhibitor of cyclooxygenase (COX) enzymes. 2-Thioisochroman-4-one is a type of fatty acid that contains a nitro group, which can be reduced to form an intramolecular hydrogen bond with the carbonyl group. 2-Thioisochroman-4-one has been studied using X-ray diffraction data and molecular modeling techniques.</p>Formula:C9H8OSPurity:Min. 95%Molecular weight:164.23 g/mol

