CAS 4427-16-1

N''-(pyridin-4-ylcarbonyl)carbonohydrazonic diamide

Description:

N''-(pyridin-4-ylcarbonyl)carbonohydrazonic diamide, with the CAS number 4427-16-1, is a chemical compound characterized by its hydrazone functional group, which is formed from the reaction of hydrazine with carbonyl compounds. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the carbonyl group linked to the hydrazone structure suggests that it may exhibit reactivity typical of carbonyl-containing compounds, such as nucleophilic addition or condensation reactions. Additionally, the hydrazonic diamide structure indicates that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological significance of hydrazones and their derivatives. Its stability, reactivity, and potential biological activity make it a subject of interest in various fields, including organic synthesis and drug design. However, specific properties such as melting point, solubility, and spectral characteristics would require empirical data for detailed analysis.

Formula: C₇H₉N₅O

InChI: InChI=1/C7H9N5O/c8-7(9)12-11-6(13)5-1-3-10-4-2-5/h1-4H,(H,11,13)(H4,8,9,12)

SMILES: c1cnccc1C(=NNC(=N)N)O

[(pyridin-4-yl)formohydrazido]methanimidamide

CAS: 4427-16-1

Formula: C₇H₉N₅O

Purity: 95.0%

Molecular weight: 179.183

Ref: 10-F541789