CAS 4427-92-3
:4-phenyl-1,3-dioxolan-2-one
Description:
4-Phenyl-1,3-dioxolan-2-one, with the CAS number 4427-92-3, is a cyclic organic compound characterized by its dioxolane ring structure, which contains two oxygen atoms and a carbonyl group. This compound features a phenyl group attached to the dioxolane, contributing to its aromatic properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the dioxolane ring suggests that it may exhibit interesting chemical reactivity, particularly in nucleophilic substitution and electrophilic addition reactions. Additionally, the compound may have applications in organic synthesis, particularly in the preparation of more complex molecules or as intermediates in various chemical processes. Its stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C9H8O3
InChI:InChI=1/C9H8O3/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2
SMILES:c1ccc(cc1)C1COC(=O)O1
Synonyms:- 1,3-Dioxolan-2-one, 4-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Carbonic acid 1-phenylethylene ester
CAS:Formula:C9H8O3Purity:98%Color and Shape:SolidMolecular weight:164.15804-phenyl-1,3-dioxolan-2-one
CAS:Controlled ProductFormula:C9H8O3Color and Shape:NeatMolecular weight:164.154-Phenyl-1,3-dioxolan-2-one
CAS:4-Phenyl-1,3-dioxolan-2-one is a chemical compound that can be synthesized using styrene and an asymmetric synthesis. It is a nonaqueous reaction with a solid catalyst and has been shown to react with halides. 4-Phenyl-1,3-dioxolan-2-one is an aromatic hydrocarbon that reacts with zirconium oxide in the presence of hydrogen fluoride to produce carbonate. This interaction produces a molecule that can be used as an intermediate in other reactions. 4-Phenyl-1,3-dioxolan-2-one has been shown to have synergistic interactions with other chemicals during experiments involving its use as a catalyst for carbonate production.Formula:C9H8O3Purity:Min. 95%Molecular weight:164.16 g/mol





