CAS 442903-28-8

Methyl 2,4-dichloronicotinate

Description:

Methyl 2,4-dichloronicotinate is an organic compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring substituted with two chlorine atoms at the 2 and 4 positions and a methoxycarbonyl group at the nitrogen position. This compound is typically characterized by its moderate polarity, which allows it to dissolve in various organic solvents while being less soluble in water. Methyl 2,4-dichloronicotinate exhibits biological activity, making it of interest in pharmaceutical research, particularly for its potential applications in agrochemicals and medicinal chemistry. Its structure contributes to its reactivity, allowing for various chemical transformations, including nucleophilic substitutions. The presence of chlorine atoms enhances its electrophilic character, which can influence its interactions with biological targets. Safety data should be consulted for handling and usage, as with many chlorinated compounds, it may pose environmental and health risks. Overall, Methyl 2,4-dichloronicotinate is a compound of interest due to its unique structural features and potential applications in various fields.

Formula: C₇H₅Cl₂NO₂

InChI: InChI=1S/C7H5Cl2NO2/c1-12-7(11)5-4(8)2-3-10-6(5)9/h2-3H,1H3

SMILES: COC(=O)c1c(ccnc1Cl)Cl

Synonyms:

• 3-Pyridinecarboxylic acid, 2,4-dichloro-, Methyl ester

Methyl 2,4-dichloronicotinate

CAS: 442903-28-8

Formula: C₇H₅Cl₂NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 206.0261

Ref: IN-DA003RLO

Methyl 2,4-dichloronicotinate

CAS: 442903-28-8

Methyl 2,4-dichloronicotinate

Formula: C₇H₅Cl₂NO₂

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 206.03g/mol

Ref: 54-OR46030

Methyl 2,4-dichloronicotinate

CAS: 442903-28-8

Formula: C₇H₅Cl₂NO₂

Purity: 97%

Molecular weight: 206.02

Ref: 10-F078708