CAS 443-09-4

1-(5-fluoro-2-hydroxyphenyl)propan-1-one

Description:

1-(5-fluoro-2-hydroxyphenyl)propan-1-one, also known by its CAS number 443-09-4, is an organic compound characterized by its ketone functional group and a substituted phenolic structure. This compound features a propan-1-one backbone, which is a three-carbon chain with a carbonyl group (C=O) at one end, and a phenyl ring that is substituted with a fluorine atom and a hydroxyl group (–OH) at the 5 and 2 positions, respectively. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, while the hydroxyl group contributes to its potential as a hydrogen bond donor. This compound may exhibit interesting chemical reactivity and biological properties, making it of interest in medicinal chemistry and material science. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks.

Formula: C₉H₉FO₂

InChI: InChI=1/C9H9FO2/c1-2-8(11)7-5-6(10)3-4-9(7)12/h3-5,12H,2H2,1H3

SMILES: CCC(=O)c1cc(ccc1O)F

Synonyms:

• 1-Propanone, 1-(5-Fluoro-2-Hydroxyphenyl)-

5'-FLUORO-2'-HYDROXYPROPIOPHENONE

CAS: 443-09-4

Formula: C₉H₉FO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.1650

Ref: IN-DA003MBI

5'-Fluoro-2'-hydroxypropiophenone

CAS: 443-09-4

5'-Fluoro-2'-hydroxypropiophenone

Purity: 99%

Molecular weight: 168.16g/mol

Ref: 54-PC9810