CymitQuimica logo

CAS 443-30-1

:

4-(1H-inden-1-ylidenemethyl)-N,N-dimethylaniline

Description:
4-(1H-Inden-1-ylidenemethyl)-N,N-dimethylaniline, with the CAS number 443-30-1, is an organic compound characterized by its complex structure, which includes an indene moiety and a dimethylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in organic synthesis and materials science. It is likely to be a solid at room temperature, with a specific melting point that can vary based on purity and crystalline form. The presence of the dimethylamino group suggests that it may exhibit basic properties, while the indene structure can impart unique electronic characteristics, making it a candidate for use in dyes, pigments, or as a building block in organic electronics. Additionally, its reactivity may allow for further functionalization, enhancing its utility in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H17N
InChI:InChI=1/C18H17N/c1-19(2)17-11-7-14(8-12-17)13-16-10-9-15-5-3-4-6-18(15)16/h3-13H,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.