CAS 443-73-2
:5-Fluoroindole-3-acetic acid
Description:
5-Fluoroindole-3-acetic acid is a chemical compound that belongs to the class of indole derivatives, characterized by the presence of a fluorine atom at the 5-position of the indole ring and an acetic acid functional group at the 3-position. This compound is known for its role as a plant growth regulator, influencing various physiological processes in plants, such as cell division and elongation. It exhibits properties that can affect plant development, making it of interest in agricultural and horticultural applications. The presence of the fluorine atom can enhance the compound's stability and bioactivity compared to its non-fluorinated counterparts. In terms of solubility, 5-Fluoroindole-3-acetic acid is typically soluble in organic solvents, which facilitates its application in various formulations. Additionally, it may exhibit specific interactions with plant hormone pathways, particularly those involving auxins, contributing to its regulatory effects. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14)
InChI key:InChIKey=GWLLOJBOPVNWNF-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(NC1)=CC=C(F)C2
Synonyms:- (5-Fluoro-1H-indol-3-yl)acetic acid
- (5-Fluoroindol-3-yl)acetic acid
- (6-fluoro-1H-indol-3-yl)acetic acid
- 1H-Indole-3-acetic acid, 5-fluoro-
- 2-(5-Fluoro-1H-indol-3-yl)acetic acid
- 2-(5-Fluoro-3-indolyl)acetic acid
- 5-Fluoro-1H-indole-3-acetic acid
- 5-Fluoro-3-indoleacetic acid
- 5-Fluoro-IAA
- 5-Fluoroindoleacetic acid
- Indole-3-acetic acid, 5-fluoro-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Fluoroindole-3-acetic acid
CAS:Formula:C10H8FNO2Purity:97%Color and Shape:SolidMolecular weight:193.1744(5-Fluoro-1H-indol-3-yl)acetic acid
CAS:(5-Fluoro-1H-indol-3-yl)acetic acidFormula:C10H8FNO2Purity:96%Color and Shape: slightly off-white powderMolecular weight:193.17442g/mol5-Fluoroindole-3-acetic acid
CAS:5-Fluoroindole-3-acetic acid is a fluorine-containing drug that inhibits the transport of indoleacetic acid (IAA), an auxin, in the peo-iaa system. It has been shown to inhibit cancer cell growth and induce apoptosis in a variety of tumour cells. 5-Fluoroindole-3-acetic acid can be used as a chemotherapeutic agent for cancers such as bladder, breast, and prostate cancers. This drug also activates enzymatic reactions by introducing fluorine atoms into reaction sites.Formula:C10H8FNO2Color and Shape:PowderMolecular weight:193.17 g/mol5-Fluoroindole-3-acetic acid
CAS:Formula:C10H8FNO2Purity:97%Color and Shape:Solid, Yellow powderMolecular weight:193.177



