CAS 443-75-4
:6-Fluoroindole-3-acetic acid
Description:
6-Fluoroindole-3-acetic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 6-position of the indole ring and an acetic acid functional group at the 3-position contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various chemical applications. It is often studied for its potential biological activities, including its role as a plant growth regulator and its interactions in biochemical pathways. The fluorine substitution can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and agricultural science. Additionally, 6-Fluoroindole-3-acetic acid may exhibit specific pharmacological properties, although detailed studies are necessary to fully understand its mechanisms of action and potential applications.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c11-7-1-2-8-6(3-10(13)14)5-12-9(8)4-7/h1-2,4-5,12H,3H2,(H,13,14)
InChI key:InChIKey=OOEZASHYQRURRT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(NC1)=CC(F)=CC2
Synonyms:- 1-Chloro-3-Fluoro-2-Methylbenzene
- 1H-Indole-3-acetic acid, 6-fluoro-
- 2-(6-Fluoro-1H-indol-3-yl)acetic acid
- 2-(6-Fluoro-1H-indol-3-yl)aceticacid
- 6-Fluoro-1H-indole-3-acetic acid
- Indole-3-acetic acid, 6-fluoro-
- Sr 043
- 6-Fluoroindole-3-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Indole-3-aceticacid, 6-fluoro-
CAS:Formula:C10H8FNO2Purity:98%Color and Shape:SolidMolecular weight:193.1744(6-Fluoro-1H-indol-3-yl)acetic acid
CAS:(6-Fluoro-1H-indol-3-yl)acetic acidPurity:98%Color and Shape:PowderMolecular weight:193.17g/mol6-Fluoroindole-3-acetic acid
CAS:<p>6-Fluoroindole-3-acetic acid (6FIAA) is a versatile building block that can be used in the synthesis of many complex compounds. 6FIAA is a fine chemical that is a reagent for the synthesis of many useful compounds and research chemicals. It has been shown to be useful as a speciality chemical, reaction component, and scaffold for the synthesis of other compounds. 6FIAA has been shown to be an intermediate in the preparation of certain pharmaceuticals, such as antihistamines, anticonvulsants, and antibiotics.</p>Formula:C10H8FNO2Molecular weight:193.18 g/mol6-Fluoroindole-3-acetic acid
CAS:Formula:C10H8FNO2Purity:98%Color and Shape:Solid, White to off-white crystalline powderMolecular weight:193.1776-Fluoroindole-3-acetic acid
CAS:<p>6-Fluoroindole-3-acetic acid is a molecule that has been synthesized by the reaction of 6-fluoroindole with acetic anhydride. When mixed with acetonitrile, the fluorescence of 6-fluoroindole-3-acetic acid can be seen in the solution. The fluorescence intensity is proportional to the concentration of this molecule. 6-Fluoroindole-3-acetic acid is used as a template molecule for fluorescence labeling experiments. It interacts with hormones and can be used to identify their conformations and interactions. This compound has been shown to have anticancer properties in mice, and it may also be effective against cancer cells in humans. It has also been shown to inhibit the growth of pisum sativum (pea).</p>Formula:C10H8FNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:193.17 g/mol



