CAS 4430-75-5
:2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine
Description:
2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine, with CAS number 4430-75-5, is a bicyclic organic compound characterized by its complex fused ring structure. This substance belongs to the class of heterocycles, specifically featuring both nitrogen and carbon atoms in its rings. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural properties that may influence biological activity. Its molecular structure contributes to its ability to interact with various biological targets, making it of interest in drug design. Additionally, it may exhibit specific physical properties such as solubility in organic solvents and moderate stability under standard conditions. However, detailed information regarding its toxicity, reactivity, and specific applications may require further investigation and should be approached with caution in laboratory settings.
Formula:C8H16N2
InChI:InChI=1/C8H16N2/c1-2-5-10-6-4-9-7-8(10)3-1/h8-9H,1-7H2
SMILES:C1CCN2CCNCC2C1
Synonyms:- 2H-Pyrido[1,2-a]pyrazine, octahydro-
- Octahydro-2H-pyrido[1,2-a]pyrazin
- Octahydro-2H-pyrido[1,2-a]pyrazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(+/-)-1,4-Diazabicyclo[4.4.0]decane, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H16N2Purity:98+%Color and Shape:LiquidMolecular weight:140.23Octahydro-2H-pyrido[1,2-a]pyrazine
CAS:Formula:C8H16N2Purity:97%Color and Shape:LiquidMolecular weight:140.22601,4-Diazabicyclo[4.4.0]decane
CAS:1,4-Diazabicyclo[4.4.0]decanePurity:95%Color and Shape:LiquidMolecular weight:140.23g/molOctahydro-pyrido[1,2- a ]pyrazine
CAS:Formula:C8H16N2Purity:≥97%Color and Shape:LiquidMolecular weight:140.23(+/-)-1,4-Diazabicyclo[4.4.0]decane
CAS:Controlled ProductFormula:C8H16N2Color and Shape:NeatMolecular weight:140.23




