CAS 4430-91-5
:2,3-dimethylcyclohexa-1,3-diene
Description:
2,3-Dimethylcyclohexa-1,3-diene is an organic compound characterized by its cyclic structure and the presence of two methyl groups attached to a cyclohexadiene framework. This compound features a six-membered carbon ring with two double bonds located at the 1 and 3 positions, contributing to its diene classification. The presence of the methyl groups at the 2 and 3 positions introduces steric effects and influences the compound's reactivity and stability. Typically, compounds like 2,3-dimethylcyclohexa-1,3-diene exhibit properties such as being colorless to pale yellow liquids with a distinct odor. They are generally less stable than their fully saturated counterparts due to the presence of double bonds, making them more reactive in various chemical reactions, including electrophilic additions. Additionally, this compound may participate in polymerization processes or serve as an intermediate in organic synthesis. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C8H12
InChI:InChI=1/C8H12/c1-7-5-3-4-6-8(7)2/h5-6H,3-4H2,1-2H3
SMILES:CC1=CCCC=C1C
Synonyms:- 1,3-Cyclohexadiene, 2,3-Dimethyl-
- 2,3-Dimethyl-1,3-cyclohexadiene
- 2,3-Dimethyl-cyclohexa-1,3-diene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cantharene
CAS:Cantharene is a medicinal compound that has been shown to have potent anticancer properties. It is an analog of cantharidin, a natural compound found in Chinese blister beetles. Cantharene works by inhibiting the activity of certain protein kinases, which are enzymes that play a critical role in cell cycle regulation and tumor growth. This inhibition has been shown to induce apoptosis, or programmed cell death, in cancer cells. Cantharene has been tested on human cancer cell lines and has demonstrated significant tumor-inhibitory effects. It is a promising candidate for the development of new cancer therapies and inhibitors.Formula:C8H12Purity:Min. 95%Molecular weight:108.18 g/mol
