CymitQuimica logo

CAS 443093-86-5

:

N-[(2′-Cyano[1,1′-biphenyl]-4-yl)methyl]-N-(1-oxopentyl)-L-valine

Description:
N-[(2′-Cyano[1,1′-biphenyl]-4-yl)methyl]-N-(1-oxopentyl)-L-valine, with CAS number 443093-86-5, is a synthetic compound that belongs to the class of amino acids and their derivatives. This substance features a complex structure characterized by a biphenyl moiety, which contributes to its unique chemical properties. The presence of a cyano group enhances its reactivity and potential applications in various chemical reactions. The L-valine component indicates that it is an amino acid derivative, which may influence its biological activity and interactions. Additionally, the oxopentyl group suggests potential for further functionalization, making it of interest in medicinal chemistry and drug design. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound may have applications in pharmaceuticals, particularly in the development of novel therapeutic agents. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C24H28N2O3
InChI:InChI=1S/C24H28N2O3/c1-4-5-10-22(27)26(23(17(2)3)24(28)29)16-18-11-13-19(14-12-18)21-9-7-6-8-20(21)15-25/h6-9,11-14,17,23H,4-5,10,16H2,1-3H3,(H,28,29)/t23-/m0/s1
InChI key:InChIKey=RPEKUWAESSKCLD-QHCPKHFHSA-N
SMILES:C(#N)C1=C(C=CC=C1)C2=CC=C(CN([C@@H]([C@@H](C)C)C(O)=O)C(CCCC)=O)C=C2
Synonyms:
  • (S)-2-[N-[(2-Cyanobiphenyl-4-yl)methyl]pentanamido]-3-methylbutanoic acid
  • N-[(2′-Cyano[1,1′-biphenyl]-4-yl)methyl]-N-(1-oxopentyl)-L-valine
  • L-Valine, N-[(2′-cyano[1,1′-biphenyl]-4-yl)methyl]-N-(1-oxopentyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.