CAS 4431-01-0: Ligustilide
Description:Ligustilide is a natural compound primarily found in various plants, particularly in the roots of Angelica species, such as Angelica gigas and Angelica sinensis. It is classified as a phthalide, which is a type of cyclic compound featuring a lactone structure. Ligustilide is known for its characteristic aromatic properties and has been studied for its potential pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective activities. The compound exhibits a pleasant, sweet, and slightly spicy aroma, making it of interest in the fragrance and flavor industries. Ligustilide is also recognized for its role in traditional medicine, particularly in East Asian herbal practices. Its solubility is generally higher in organic solvents than in water, which influences its extraction and application in various formulations. Additionally, research continues to explore its mechanisms of action and potential therapeutic uses, highlighting its significance in both natural product chemistry and medicinal applications.
Formula:C12H14O2
InChI:InChI=1S/C12H14O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7-8H,2-4,6H2,1H3
InChI key:InChIKey=IQVQXVFMNOFTMU-UHFFFAOYSA-N
SMILES:O=C1OC(=CCCC)C2=C1C=CCC2
- Synonyms:
- (3Z)-3-butylidene-4,5-dihydro-2-benzofuran-1(3H)-one
- 1(3H)-Isobenzofuranone, 3-butylidene-4,5-dihydro-
- 1,5-Cyclohexadiene-1-carboxylic acid, 2-(1-hydroxy-1-pentenyl)-, γ-lactone
- 1-ethyl-1-methyl-1,1a,6,7-tetrahydrocyclopropa[c][2]benzofuran-3(3aH)-one
- 3-Butylidene-4,5-dihydro-1(3H)-isobenzofuranone
- 3-Butylidene-4,5-dihydro-2-benzofuran-1-one
- 3-Butylidene-4,5-dihydrophthalide
- Angelica Sinensis Extract
- Angelica extract
- Phthalide, 3-butylidene-4,5-dihydro-
- See more synonyms
- Ligustilide
