CAS 443124-79-6

3-chloro-4-[(4-chlorobenzyl)oxy]benzaldehyde

Description:

3-Chloro-4-[(4-chlorobenzyl)oxy]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and ether linkage. The presence of chlorine substituents on the benzene rings contributes to its reactivity and potential applications in various chemical reactions, such as electrophilic aromatic substitution. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic nature. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The chlorine atoms can enhance the compound's biological activity and influence its interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-chloro-4-[(4-chlorobenzyl)oxy]benzaldehyde is a versatile compound with significant implications in synthetic chemistry and material science.

Formula: C₁₄H₁₀Cl₂O₂

InChI: InChI=1/C14H10Cl2O2/c15-12-4-1-10(2-5-12)9-18-14-6-3-11(8-17)7-13(14)16/h1-8H,9H2

SMILES: c1cc(ccc1COc1ccc(cc1Cl)C=O)Cl

Synonyms:

• Benzaldehyde, 3-Chloro-4-[(4-Chlorophenyl)Methoxy]-

3-chloro-4-[(4-chlorobenzyl)oxy]benzaldehyde

CAS: 443124-79-6

Formula: C₁₄H₁₀Cl₂O₂

Purity: 95.0%

Molecular weight: 281.13

Ref: 10-F315220