CAS 443649-18-1

(5-amino-3-pyridyl)methanol

Description:

(5-amino-3-pyridyl)methanol is an organic compound characterized by its pyridine ring structure, which features an amino group and a hydroxymethyl group attached to the ring. The presence of the amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydroxymethyl group enhances its solubility in polar solvents, making it suitable for various applications in organic synthesis. This compound may exhibit biological activity due to the functional groups present, which can interact with biological targets. Its molecular structure allows for potential hydrogen bonding, influencing its physical properties such as melting point and boiling point. Additionally, (5-amino-3-pyridyl)methanol may be used in research settings to explore its reactivity and interactions with other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₆H₈N₂O

InChI: InChI=1/C6H8N2O/c7-6-1-5(4-9)2-8-3-6/h1-3,9H,4,7H2

SMILES: c1c(cncc1N)CO

Synonyms:

• (5-Aminopyridin-3-yl)methanol
• 3-Amino-5-hydroxymethylpyridine
• 3-Pyridinemethanol, 5-Amino-

3-AMINO-5-HYDROXYMETHYLPYRIDINE

CAS: 443649-18-1

Formula: C₆H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 124.1405

Ref: IN-DA00DDXT

(5-Aminopyridin-3-yl)methanol

CAS: 443649-18-1

(5-Aminopyridin-3-yl)methanol

Purity: 98%

Molecular weight: 124.14g/mol

Ref: 54-OR93998

(5-Aminopyridin-3-yl)methanol

CAS: 443649-18-1

Formula: C₆H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 124.143

Ref: 10-F329558

(5-Aminopyridin-3-yl)methanol

CAS: 443649-18-1

5-Aminopyridin-3-yl)methanol is a synthetic molecule that can be used in the synthesis of porphyrins, which are organic compounds. The molecule has been shown to have peroxidase-like activity and can be used as a traceless reagent for conjugation. 5-Aminopyridin-3-yl)methanol is synthesized from an alkyne and methylamine, using the Staudinger ligation reaction. It is also possible to synthesize 5-aminopyridin-3-yl)methanol by reacting azide with an olefin or alkene. This method involves a synthetic chemistry methodology that makes it possible to modify the chemical structure at any position on the molecule.

Purity: Min. 95%

Ref: 3D-FA142764