CAS 443913-79-9

[4-Amino-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-5-thiazolyl](2,3-dihydro-1,4-benzodioxin-6-yl)methanone

Description:

The chemical substance known as [4-Amino-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-5-thiazolyl](2,3-dihydro-1,4-benzodioxin-6-yl)methanone, with CAS number 443913-79-9, is a complex organic compound characterized by its multi-functional structure. It features a thiazole ring, which is known for its biological activity, and a benzodioxin moiety that contributes to its potential pharmacological properties. The presence of amino groups suggests that it may engage in hydrogen bonding, enhancing its solubility and reactivity. The piperazine ring is often associated with various therapeutic effects, particularly in the context of neuropharmacology. This compound may exhibit significant biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways. Its intricate structure indicates potential for diverse interactions within biological systems, making it a candidate for further research in medicinal chemistry. As with many compounds of this nature, understanding its pharmacokinetics, toxicity, and efficacy would be essential for any therapeutic applications.

Formula: C₂₃H₂₅N₅O₃S

InChI: InChI=1S/C23H25N5O3S/c1-27-8-10-28(11-9-27)17-5-3-16(4-6-17)25-23-26-22(24)21(32-23)20(29)15-2-7-18-19(14-15)31-13-12-30-18/h2-7,14H,8-13,24H2,1H3,(H,25,26)

InChI key: InChIKey=YGEYFDLYGXSZCP-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(NC2=CC=C(C=C2)N3CCN(C)CC3)=NC1N)C=4C=C5C(=CC4)OCCO5

Synonyms:

• [4-Amino-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-5-thiazolyl](2,3-dihydro-1,4-benzodioxin-6-yl)methanone
• Methanone, [4-amino-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-5-thiazolyl](2,3-dihydro-1,4-benzodioxin-6-yl)-

Ro-0505124

CAS: 443913-79-9

Ro-0505124 is a potent, selective and ATP-competitive inhibitor of cyclin-dependent kinase 4 (CDK4).

Formula: C₂₃H₂₅N₅O₃S

Color and Shape: Solid

Molecular weight: 451.54

Ref: TM-T28595