CAS 443915-58-0

2-Bromo-1-[3-(methylsulfonyl)phenyl]ethanone

Description:

2-Bromo-1-[3-(methylsulfonyl)phenyl]ethanone is an organic compound characterized by its bromine and methylsulfonyl functional groups. It features a bromine atom attached to a carbon adjacent to a ketone group, which is further connected to a phenyl ring that has a methylsulfonyl substituent. This compound is typically a solid at room temperature and is soluble in organic solvents due to its polar functional groups. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The methylsulfonyl group contributes to its solubility and can influence the compound's biological activity. As with many halogenated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, 2-Bromo-1-[3-(methylsulfonyl)phenyl]ethanone is a versatile compound in organic chemistry with potential applications in medicinal chemistry and material science.

Formula: C₉H₉BrO₃S

InChI: InChI=1S/C9H9BrO3S/c1-14(12,13)8-4-2-3-7(5-8)9(11)6-10/h2-5H,6H2,1H3

InChI key: InChIKey=FASDZVWZMAQOAW-UHFFFAOYSA-N

SMILES: C(CBr)(=O)C1=CC(S(C)(=O)=O)=CC=C1

3-(Methylsulphonyl)phenacyl bromide

CAS: 443915-58-0

3-(Methylsulphonyl)phenacyl bromide

Purity: ≥95%

Molecular weight: 277.13g/mol

Ref: 54-OR400539

2-Bromo-1-(3-methanesulfonylphenyl)ethan-1-one

CAS: 443915-58-0

2-Bromo-1-(3-methanesulfonylphenyl)ethan-1-one is a fine chemical that has been used as a building block for research chemicals, reagents, and speciality chemicals. It is a versatile building block that can be used in multi-step reactions to form complex compounds. This compound is also an intermediate in the synthesis of many pharmaceuticals and agrochemicals.

Formula: C₉H₉BrO₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 277.14 g/mol

Ref: 3D-TSA91558