
CAS 443956-16-9
:3,4-Dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-thiazine-6-carboxaldehyde
Description:
3,4-Dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-thiazine-6-carboxaldehyde is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a thiazine ring. This compound features a carbonyl group and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the thiazine ring suggests that it may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability. The compound is typically synthesized through multi-step reactions involving specific reagents and conditions that facilitate the formation of the thiazine and pyridine moieties. As with many heterocycles, it may exhibit properties such as fluorescence or specific reactivity patterns, which can be exploited in various chemical applications, including drug development and material science. Safety and handling precautions should be observed due to the potential toxicity associated with certain nitrogen and sulfur-containing compounds.
Formula:C8H6N2O2S
InChI:InChI=1S/C8H6N2O2S/c11-3-5-1-2-6-8(9-5)10-7(12)4-13-6/h1-3H,4H2,(H,9,10,12)
InChI key:InChIKey=VEPGNAIYGRUSIA-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C2C(=CC1)SCC(=O)N2
Synonyms:- 3,4-Dihydro-3-oxo-2H-pyrido[3,2-b]-1,4-thiazine-6-carboxaldehyde
- 2H-Pyrido[3,2-b]-1,4-thiazine-6-carboxaldehyde, 3,4-dihydro-3-oxo-
- 3-Oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]thiazine-6-carboxaldehyde
- 3-Oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]thiazine-6-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-oxo-2H,3H,4H-pyrido[3,2-b][1,4]thiazine-6-carbaldehyde
CAS:Formula:C8H6N2O2SMolecular weight:194.2104
