CAS 4440-92-0
:1,4-Bis(3,4-dimethoxyphenyl)-2,3-dimethyl-1,4-butanedione
Description:
1,4-Bis(3,4-dimethoxyphenyl)-2,3-dimethyl-1,4-butanedione, with CAS number 4440-92-0, is an organic compound characterized by its complex structure featuring two 3,4-dimethoxyphenyl groups attached to a central butanedione moiety. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as a dye or pigment due to its chromophoric properties. It is soluble in organic solvents, which enhances its utility in various chemical reactions. The presence of methoxy groups contributes to its electron-donating characteristics, influencing its reactivity and stability. Additionally, the compound may exhibit interesting photophysical properties, making it a subject of study in materials science and organic electronics. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, its unique structural features and properties make it a valuable compound in both research and industrial applications.
Formula:C22H26O6
InChI:InChI=1S/C22H26O6/c1-13(21(23)15-7-9-17(25-3)19(11-15)27-5)14(2)22(24)16-8-10-18(26-4)20(12-16)28-6/h7-14H,1-6H3
InChI key:InChIKey=SPBNPRXRUYBFDV-UHFFFAOYSA-N
SMILES:C(C(C(C(=O)C1=CC(OC)=C(OC)C=C1)C)C)(=O)C2=CC(OC)=C(OC)C=C2
Synonyms:- 1,4-Bis(3,4-dimethoxyphenyl)-2,3-dimethyl-1,4-butanedione
- 1,4-Butanedione, 1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
