CAS 444088-20-4

Methyl (1α,3α,5α)-3-(aminomethyl)bicyclo[3.2.0]heptane-3-acetate

Description:

Methyl (1α,3α,5α)-3-(aminomethyl)bicyclo[3.2.0]heptane-3-acetate, with CAS number 444088-20-4, is a bicyclic compound characterized by its unique bicyclo[3.2.0]heptane structure, which consists of a seven-membered ring system. This compound features an aminomethyl group and an acetate moiety, contributing to its potential biological activity. The presence of the amino group suggests that it may engage in hydrogen bonding and participate in various chemical reactions, making it of interest in medicinal chemistry. The methyl ester functionality indicates that it can undergo hydrolysis to release the corresponding acid, which may have implications for its pharmacokinetics. Additionally, the stereochemistry denoted by the 1α, 3α, and 5α configurations indicates specific spatial arrangements of substituents, which can significantly influence the compound's interactions with biological targets. Overall, this compound's structural features suggest potential applications in drug development, particularly in the context of neuropharmacology or as a scaffold for further chemical modifications.

Formula: C₁₁H₁₉NO₂

InChI: InChI=1/C11H19NO2/c1-14-10(13)6-11(7-12)4-8-2-3-9(8)5-11/h8-9H,2-7,12H2,1H3/t8-,9+,11-

InChI key: InChIKey=ASBDKEXHKWHAPE-DOFRTFSJNA-N

SMILES: C(C(OC)=O)[C@@]1(CN)C[C@@]2([C@](C1)(CC2)[H])[H]

Synonyms:

• Methyl (1α,3α,5α)-3-(aminomethyl)bicyclo[3.2.0]heptane-3-acetate
• Bicyclo[3.2.0]heptane-3-acetic acid, 3-(aminomethyl)-, methyl ester, (1α,3α,5α)-
• Bicyclo[3.2.0]heptane-3-acetic acid, 3-(aminomethyl)-, methyl ester

PD-217014 HCl

CAS: 444088-20-4

PD-217014, a GABA analog, blocks (3)H-gabapentin on alpha(2)delta calcium channels (K(i) 18 nmol/l), and is a visceral analgesic.

Formula: C₁₁H₁₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.27

Ref: TM-T28346