CAS 4441-12-7: Morpholine, 4,4′,4′′-phosphinylidynetris-
Description:Morpholine, 4,4′,4′′-phosphinylidynetris- (CAS 4441-12-7) is a chemical compound characterized by its unique structure, which includes a morpholine ring and a phosphinylidynetris functional group. This compound typically exhibits properties associated with both morpholine derivatives and phosphorous-containing compounds. Morpholine itself is a cyclic amine known for its solubility in water and organic solvents, while phosphinylidynetris groups can impart specific reactivity and stability characteristics. The presence of the phosphinylidynetris moiety suggests potential applications in areas such as organic synthesis, catalysis, or as a ligand in coordination chemistry. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. Safety and handling considerations are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, Morpholine, 4,4′,4′′-phosphinylidynetris- represents a complex chemical entity with diverse applications and implications in various fields of chemistry.
Formula:C12H24N3O4P
InChI:InChI=1S/C12H24N3O4P/c16-20(13-1-7-17-8-2-13,14-3-9-18-10-4-14)15-5-11-19-12-6-15/h1-12H2
InChI key:InChIKey=WXMQHPKQCPCDQO-UHFFFAOYSA-N
SMILES:O=P(N1CCOCC1)(N2CCOCC2)N3CCOCC3
- Synonyms:
- Morpholine, 4,4′,4′′-phosphinylidynetris-
- Morpholine, 4-(Di-4-Morpholinylphosphinyl)-
- Morpholine, 4-[di(4-morpholinyl)phosphinyl]-
- NSC 41250
- Phosphine oxide, trimorpholino-
- Phosphoric acid trimorpholide
- Phosphoric trimorpholide
- Phosphoryl trimorpholide
- Tri(4-morpholino)phosphine oxide
- Trimorpholinophosphine oxide
- See more synonyms
- Tris(4-Morpholino)Phosphine Oxide
- Tris-(morpholino)-phosphine oxide
- 4,4',4''-phosphoryltrimorpholine
