CAS 444120-91-6
:6-Chloropyridine-3-boronic acid
Description:
6-Chloropyridine-3-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated pyridine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is a common trait of boronic acids due to their ability to form hydrogen bonds. The presence of the chlorine atom at the 6-position of the pyridine ring influences its reactivity and can enhance its utility in various chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key building block for the synthesis of biaryl compounds. Additionally, the boronic acid group allows for the formation of reversible covalent bonds with diols, making it useful in applications such as drug delivery and sensor technology. Overall, 6-Chloropyridine-3-boronic acid is valued in organic synthesis and medicinal chemistry for its versatile reactivity and functional properties.
Formula:C5H5BClNO2
InChI:InChI=1/C5H5BClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3,9-10H
SMILES:c1cc(Cl)ncc1B(O)O
Synonyms:- Boronic acid, B-(6-chloro-3-pyridinyl)-
- 2-Chloro-5-pyridineboronic acid
- (6-Chloropyridin-3-Yl)Boronic Acid
- 2-Chloropyridine-5-boronic acid
- 2-Chloro-5-Pyridyl Boronic Acid
- 6-Chloropyridin-3-Yl-3-Boronic Acid
- 6-Chloropyridin-3-Ylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Chloropyridine-5-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BClNO2Purity:96.0 to 113.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:157.366-Chloropyridine-3-boronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H5BClNO2Purity:96%Color and Shape:Powder, White to cream to pale yellowMolecular weight:157.362-Chloropyridine-5-boronic acid
CAS:Formula:C5H5BClNO2Purity:97%Color and Shape:SolidMolecular weight:157.36272-Chloropyridine-5-boronic acid
CAS:2-Chloropyridine-5-boronic acidFormula:C5H5BClNO2Purity:98%Color and Shape: white powderMolecular weight:157.36g/mol2-Chloropyridine-5-boronic acid
CAS:Formula:C5H5BClNO2Purity:97%Color and Shape:White to Off-White to Light Yellow to Light OrangeMolecular weight:157.36





