CAS 4444-27-3
:4,4′,6,6′-Tetramethyl-2,2′-bipyridine
Description:
4,4′,6,6′-Tetramethyl-2,2′-bipyridine, with the CAS number 4444-27-3, is an organic compound belonging to the class of bipyridines, which are characterized by two pyridine rings connected by a carbon-carbon bond. This particular compound features four methyl groups attached to the bipyridine structure, specifically at the 4 and 6 positions of each pyridine ring, enhancing its steric bulk and influencing its chemical reactivity. It is typically a solid at room temperature and exhibits good solubility in organic solvents due to its non-polar methyl groups. The presence of nitrogen atoms in the pyridine rings contributes to its basicity and potential coordination properties with metal ions, making it useful in various applications, including catalysis and as a ligand in coordination chemistry. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system of the aromatic rings, which can be exploited in organic electronics or as a dye. Safety data should be consulted for handling, as with all chemical substances.
Formula:C14H16N2
InChI:InChI=1S/C14H16N2/c1-9-5-11(3)15-13(7-9)14-8-10(2)6-12(4)16-14/h5-8H,1-4H3
InChI key:InChIKey=SMLORZJGJAWILX-UHFFFAOYSA-N
SMILES:CC=1C=C(N=C(C)C1)C2=CC(C)=CC(C)=N2
Synonyms:- 2,2'-Bipyridine, 4,4',6,6'-Tetramethyl-
- 2,2′-Bipyridine, 4,4′,6,6′-tetramethyl-
- 4,4',6,6'-Tetramethyl-2,2'-bipyridin
- 4,4′,6,6′-Tetramethyl-2,2′-bipyridine
- 4444-27-3
- 6,6′-Bi-2,4-lutidine
- 4,4',6,6'-Tetramethyl-2,2'-bipyridine
- 4,4',6,6'-Tétraméthyl-2,2'-bipyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,4',6,6'-Tetramethyl-2,2'-bipyridine
CAS:4,4',6,6'-Tetramethyl-2,2'-bipyridinePurity:97%Molecular weight:212.29g/mol4,4',6,6'-Tetramethyl-2,2'-bipyridine
CAS:4,4',6,6'-Tetramethyl-2,2'-bipyridine (TMTB) is a small molecule that can be used as an efficient and cost-effective catalyst for the production of hydrogen from water. TMTB is able to transform solar energy into chemical energy by converting light absorbed in a semiconductor material to an electric current. TMTB has been shown to improve the efficiency of solar cells by boosting the performance of the catalysts that drive chemical reactions in the devices. This effect was found to be synergistic with other materials such as graphene oxide and tungsten disulfide. In addition, TMTB nanoparticles were shown to have a normalizing effect on the charge density in photoelectrochemical cells, which may lead to improved stability and durability.Formula:C14H16N2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:212.30 g/mol



