CAS 4444-43-3
:5H-Dibenzo[a,c]cyclohepten-5-one
Description:
5H-Dibenzo[a,c]cyclohepten-5-one, with the CAS number 4444-43-3, is an organic compound characterized by its unique bicyclic structure, which consists of two fused benzene rings and a cycloheptenone moiety. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of multiple conjugated double bonds. It has a distinct chemical reactivity, often participating in electrophilic aromatic substitution reactions. The presence of the ketone functional group contributes to its reactivity and can influence its physical properties, such as solubility and boiling point. Additionally, 5H-Dibenzo[a,c]cyclohepten-5-one may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and organic synthesis. Its structural features also allow for potential applications in the development of dyes, pharmaceuticals, and other organic materials. Overall, this compound is notable for its complex structure and potential utility in various chemical applications.
Formula:C15H10O
InChI:InChI=1/C15H10O/c16-15-10-9-11-5-1-2-6-12(11)13-7-3-4-8-14(13)15/h1-10H
InChI key:InChIKey=WJFOWHGZSALYEC-UHFFFAOYSA-N
SMILES:O=C1C=2C(C=3C(C=C1)=CC=CC3)=CC=CC2
Synonyms:- 5H-Dibenzo(a,c)cyclohepten-5-one
- 5H-Dibenzo[a,c]cyclohepten-5-one
- 5H-Dibenzo[a,c]cyclohepten-5-one
- 2,3:4,5-Dibenzotropone
- NSC 647348
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
